C9H10N2O5 — CID 112616422
methyl 2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-2-oxoacetate (PubChem CID 112616422) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is methyl 2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-2-oxoacetate.
| Compound Name | methyl 2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 112616422 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | methyl 2-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H10N2O5/c1-10-4-5(6(12)8(14)16-3)7(13)11(2)9(10)15/h4H,1-3H3 |
| InChIKey | WJYJEKQPNCYVAZ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|