C7H6N2O5 — CID 54460567
methyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoacetate (PubChem CID 54460567) has the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. Its IUPAC name is methyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoacetate.
| Compound Name | methyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 54460567 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | methyl 2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H6N2O5/c1-14-6(12)4(10)3-2-8-7(13)9-5(3)11/h2H,1H3,(H2,8,9,11,13) |
| InChIKey | XBHZYTRAJOAIMT-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|