C9H11NO4 — CID 112617149
methyl 2-[(5-methylfuran-2-yl)methylamino]-2-oxoacetate (PubChem CID 112617149) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 2-[(5-methylfuran-2-yl)methylamino]-2-oxoacetate.
| Compound Name | methyl 2-[(5-methylfuran-2-yl)methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 112617149 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | methyl 2-[(5-methylfuran-2-yl)methylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCc1ccc(C)o1 |
| InChI | InChI=1S/C9H11NO4/c1-6-3-4-7(14-6)5-10-8(11)9(12)13-2/h3-4H,5H2,1-2H3,(H,10,11) |
| InChIKey | ANYHSTKMVXXMLF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|