C9H13FN2O2 — CID 25119845
1-(2-fluoroethyl)-3-[(5-methylfuran-2-yl)methyl]urea (PubChem CID 25119845) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-[(5-methylfuran-2-yl)methyl]urea.
| Compound Name | 1-(2-fluoroethyl)-3-[(5-methylfuran-2-yl)methyl]urea |
|---|---|
| PubChem CID | 25119845 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(2-fluoroethyl)-3-[(5-methylfuran-2-yl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)NCCF)o1 |
| InChI | InChI=1S/C9H13FN2O2/c1-7-2-3-8(14-7)6-12-9(13)11-5-4-10/h2-3H,4-6H2,1H3,(H2,11,12,13) |
| InChIKey | VNCAKMLXWLUQQC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |