C14H18ClN3O — CID 112617875
1-(5-chloroquinolin-8-yl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 112617875) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-(5-chloroquinolin-8-yl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | 1-(5-chloroquinolin-8-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112617875 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(5-chloroquinolin-8-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNC(CN)c1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H18ClN3O/c1-19-8-7-17-13(9-16)11-4-5-12(15)10-3-2-6-18-14(10)11/h2-6,13,17H,7-9,16H2,1H3 |
| InChIKey | PIBWTXXKSWVWMH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|