C13H17ClN4 — CID 112617884
2-(5-chloroquinolin-8-yl)-2-(2,2-dimethylhydrazinyl)ethanamine (PubChem CID 112617884) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)-2-(2,2-dimethylhydrazinyl)ethanamine.
| Compound Name | 2-(5-chloroquinolin-8-yl)-2-(2,2-dimethylhydrazinyl)ethanamine |
|---|---|
| PubChem CID | 112617884 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)-2-(2,2-dimethylhydrazinyl)ethanamine |
| SMILES | CN(C)NC(CN)c1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C13H17ClN4/c1-18(2)17-12(8-15)10-5-6-11(14)9-4-3-7-16-13(9)10/h3-7,12,17H,8,15H2,1-2H3 |
| InChIKey | UMJOFDQFQMBIOT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|