methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate

C7H10N2O3 — CID 112618977

IUPACmethyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(C(C)C)o1
InChIInChI=1S/C7H10N2O3/c1-4(2)5-8-9-6(12-5)7(10)11-3/h4H,1-3H3
InChIKeyCVTNUWOIZULRMH-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.98
Rot. Bonds2

About methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate

methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112618977) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate
PubChem CID112618977
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Namemethyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(C(C)C)o1
InChIInChI=1S/C7H10N2O3/c1-4(2)5-8-9-6(12-5)7(10)11-3/h4H,1-3H3
InChIKeyCVTNUWOIZULRMH-UHFFFAOYSA-N
XLogP0.98
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate (CID 112618977) is methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(C(C)C)o1.
What is the InChIKey of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is CVTNUWOIZULRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-4(2)5-8-9-6(12-5)7(10)11-3/h4H,1-3H3.
What are the key properties of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 170.17 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112618977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).