About methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate
methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112618977) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate.
Analyze methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate (CID 112618977) is methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(C(C)C)o1.
What is the InChIKey of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is CVTNUWOIZULRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-4(2)5-8-9-6(12-5)7(10)11-3/h4H,1-3H3.
What are the key properties of methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate?
methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 170.17 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-propan-2-yl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112618977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).