5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid

C9H4ClFN2O3 — CID 112619602

IUPAC5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(-c2ccc(F)c(Cl)c2)o1
InChIInChI=1S/C9H4ClFN2O3/c10-5-3-4(1-2-6(5)11)7-12-13-8(16-7)9(14)15/h1-3H,(H,14,15)
InChIKeyWDIKEDHIPAFKNP-UHFFFAOYSA-N
MW242.59 g/mol
LogP2.23
Rot. Bonds2

About 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid

5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 112619602) has the molecular formula C9H4ClFN2O3 and a molecular weight of 242.59 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid
PubChem CID112619602
Molecular FormulaC9H4ClFN2O3
Molecular Weight242.59 g/mol
Exact Mass241.99
IUPAC Name5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(-c2ccc(F)c(Cl)c2)o1
InChIInChI=1S/C9H4ClFN2O3/c10-5-3-4(1-2-6(5)11)7-12-13-8(16-7)9(14)15/h1-3H,(H,14,15)
InChIKeyWDIKEDHIPAFKNP-UHFFFAOYSA-N
XLogP2.23
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.59
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid?
The IUPAC name of 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid (CID 112619602) is 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid.
What is the SMILES notation for 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid?
The canonical SMILES for 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid is O=C(O)c1nnc(-c2ccc(F)c(Cl)c2)o1.
What is the InChIKey of 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid?
The InChIKey is WDIKEDHIPAFKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClFN2O3/c10-5-3-4(1-2-6(5)11)7-12-13-8(16-7)9(14)15/h1-3H,(H,14,15).
What are the key properties of 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid?
5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid has a molecular weight of 242.59 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloro-4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid is sourced from PubChem (CID 112619602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).