C12H14BrNO — CID 112620121
1-(5-bromo-3-methyl-2-prop-2-ynoxyphenyl)-N-methylmethanamine (PubChem CID 112620121) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 1-(5-bromo-3-methyl-2-prop-2-ynoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-3-methyl-2-prop-2-ynoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 112620121 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 1-(5-bromo-3-methyl-2-prop-2-ynoxyphenyl)-N-methylmethanamine |
| SMILES | C#CCOc1c(C)cc(Br)cc1CNC |
| InChI | InChI=1S/C12H14BrNO/c1-4-5-15-12-9(2)6-11(13)7-10(12)8-14-3/h1,6-7,14H,5,8H2,2-3H3 |
| InChIKey | BTOPOQHQUXPLSC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|