C13H18BrF2NO2 — CID 112620536
N-[[5-bromo-2-(2,2-difluoroethoxy)-3-methylphenyl]methyl]-2-methoxyethanamine (PubChem CID 112620536) has the molecular formula C13H18BrF2NO2 and a molecular weight of 338.19 g/mol. Its IUPAC name is N-[[5-bromo-2-(2,2-difluoroethoxy)-3-methylphenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-bromo-2-(2,2-difluoroethoxy)-3-methylphenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 112620536 |
| Molecular Formula | C13H18BrF2NO2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-[[5-bromo-2-(2,2-difluoroethoxy)-3-methylphenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Br)cc(C)c1OCC(F)F |
| InChI | InChI=1S/C13H18BrF2NO2/c1-9-5-11(14)6-10(7-17-3-4-18-2)13(9)19-8-12(15)16/h5-6,12,17H,3-4,7-8H2,1-2H3 |
| InChIKey | ZOVQFFCSKXKHCW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|