C15H22BrNO4 — CID 115961768
2-[4-bromo-2-[(2-methoxyethylamino)methyl]-6-methylphenoxy]butanoic acid (PubChem CID 115961768) has the molecular formula C15H22BrNO4 and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2-methoxyethylamino)methyl]-6-methylphenoxy]butanoic acid.
| Compound Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]-6-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 115961768 |
| Molecular Formula | C15H22BrNO4 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]-6-methylphenoxy]butanoic acid |
| SMILES | CCC(Oc1c(C)cc(Br)cc1CNCCOC)C(=O)O |
| InChI | InChI=1S/C15H22BrNO4/c1-4-13(15(18)19)21-14-10(2)7-12(16)8-11(14)9-17-5-6-20-3/h7-8,13,17H,4-6,9H2,1-3H3,(H,18,19) |
| InChIKey | GKWXFDWNQGGAQX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|