C13H14BrFO3 — CID 112621442
(E)-3-[5-bromo-2-(3-fluoropropoxy)-3-methylphenyl]prop-2-enoic acid (PubChem CID 112621442) has the molecular formula C13H14BrFO3 and a molecular weight of 317.15 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(3-fluoropropoxy)-3-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-2-(3-fluoropropoxy)-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112621442 |
| Molecular Formula | C13H14BrFO3 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (E)-3-[5-bromo-2-(3-fluoropropoxy)-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Br)cc(/C=C/C(=O)O)c1OCCCF |
| InChI | InChI=1S/C13H14BrFO3/c1-9-7-11(14)8-10(3-4-12(16)17)13(9)18-6-2-5-15/h3-4,7-8H,2,5-6H2,1H3,(H,16,17)/b4-3+ |
| InChIKey | KOBFBUJPQBZPAC-ONEGZZNKSA-N |
| XLogP | 3.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|