C14H14BrN3O3 — CID 107044199
(E)-3-[5-bromo-3-methyl-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 107044199) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is (E)-3-[5-bromo-3-methyl-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-3-methyl-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107044199 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | (E)-3-[5-bromo-3-methyl-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Br)cc(/C=C/C(=O)O)c1OCc1cn(C)nn1 |
| InChI | InChI=1S/C14H14BrN3O3/c1-9-5-11(15)6-10(3-4-13(19)20)14(9)21-8-12-7-18(2)17-16-12/h3-7H,8H2,1-2H3,(H,19,20)/b4-3+ |
| InChIKey | YRAVDQNLVWSBMC-ONEGZZNKSA-N |
| XLogP | 2.56 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|