C13H12FN3O3 — CID 107044193
(E)-3-[3-fluoro-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 107044193) has the molecular formula C13H12FN3O3 and a molecular weight of 277.26 g/mol. Its IUPAC name is (E)-3-[3-fluoro-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107044193 |
| Molecular Formula | C13H12FN3O3 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (E)-3-[3-fluoro-2-[(1-methyltriazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cn1cc(COc2c(F)cccc2/C=C/C(=O)O)nn1 |
| InChI | InChI=1S/C13H12FN3O3/c1-17-7-10(15-16-17)8-20-13-9(5-6-12(18)19)3-2-4-11(13)14/h2-7H,8H2,1H3,(H,18,19)/b6-5+ |
| InChIKey | NIACSFMDRFGPJB-AATRIKPKSA-N |
| XLogP | 1.63 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|