C11H21N3O3S — CID 112622473
2-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylbutanenitrile (PubChem CID 112622473) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylbutanenitrile.
| Compound Name | 2-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 112622473 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylbutanenitrile |
| SMILES | CCC(C#N)S(=O)(=O)N1CCC(OC)CC1CN |
| InChI | InChI=1S/C11H21N3O3S/c1-3-11(8-13)18(15,16)14-5-4-10(17-2)6-9(14)7-12/h9-11H,3-7,12H2,1-2H3 |
| InChIKey | DMQBUYFZVQOVBH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |