C10H22N2O4S — CID 112622474
[4-methoxy-1-(2-methoxyethylsulfonyl)piperidin-2-yl]methanamine (PubChem CID 112622474) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is [4-methoxy-1-(2-methoxyethylsulfonyl)piperidin-2-yl]methanamine.
| Compound Name | [4-methoxy-1-(2-methoxyethylsulfonyl)piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 112622474 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [4-methoxy-1-(2-methoxyethylsulfonyl)piperidin-2-yl]methanamine |
| SMILES | COCCS(=O)(=O)N1CCC(OC)CC1CN |
| InChI | InChI=1S/C10H22N2O4S/c1-15-5-6-17(13,14)12-4-3-10(16-2)7-9(12)8-11/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | WFZSJSIXRVAXKL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |