About [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol
[1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol (PubChem CID 112624471) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol |
| PubChem CID | 112624471 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol |
| SMILES | CCC(N)C(N1CCC(CO)C1)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-2-8(14)9(10(11,12)13)15-4-3-7(5-15)6-16/h7-9,16H,2-6,14H2,1H3 |
| InChIKey | UVPAYBVIXJZARK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol?
The IUPAC name of [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol (CID 112624471) is [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol is CCC(N)C(N1CCC(CO)C1)C(F)(F)F.
What is the InChIKey of [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol?
The InChIKey is UVPAYBVIXJZARK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-2-8(14)9(10(11,12)13)15-4-3-7(5-15)6-16/h7-9,16H,2-6,14H2,1H3.
What are the key properties of [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol?
[1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol has a molecular weight of 240.27 g/mol, XLogP of 0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-amino-1,1,1-trifluoropentan-2-yl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 112624471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).