C12H16BrN — CID 112631023
(3-bromo-5-methylphenyl)-cyclobutylmethanamine (PubChem CID 112631023) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is (3-bromo-5-methylphenyl)-cyclobutylmethanamine.
| Compound Name | (3-bromo-5-methylphenyl)-cyclobutylmethanamine |
|---|---|
| PubChem CID | 112631023 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (3-bromo-5-methylphenyl)-cyclobutylmethanamine |
| SMILES | Cc1cc(Br)cc(C(N)C2CCC2)c1 |
| InChI | InChI=1S/C12H16BrN/c1-8-5-10(7-11(13)6-8)12(14)9-3-2-4-9/h5-7,9,12H,2-4,14H2,1H3 |
| InChIKey | FMVDTLCHTWHKCS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |