C12H15N3O4 — CID 112632394
methyl 4-hydroxy-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 112632394) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632394 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 4-hydroxy-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1C(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C12H15N3O4/c1-7-4-14-9(5-13-7)11(17)15-6-8(16)3-10(15)12(18)19-2/h4-5,8,10,16H,3,6H2,1-2H3 |
| InChIKey | JBQJBJVJIHQKRU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |