C12H15N3O5 — CID 115971005
methyl 4-hydroxy-1-(1-methyl-6-oxopyridazine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 115971005) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(1-methyl-6-oxopyridazine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(1-methyl-6-oxopyridazine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115971005 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | methyl 4-hydroxy-1-(1-methyl-6-oxopyridazine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1C(=O)c1ccc(=O)n(C)n1 |
| InChI | InChI=1S/C12H15N3O5/c1-14-10(17)4-3-8(13-14)11(18)15-6-7(16)5-9(15)12(19)20-2/h3-4,7,9,16H,5-6H2,1-2H3 |
| InChIKey | QQDIHOLTTORISL-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |