C13H18N2O4 — CID 112632824
methyl 4-hydroxy-1-[(6-methoxy-2-pyridinyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 112632824) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 4-hydroxy-1-[(6-methoxy-2-pyridinyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-[(6-methoxy-2-pyridinyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632824 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 4-hydroxy-1-[(6-methoxy-2-pyridinyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1Cc1cccc(OC)n1 |
| InChI | InChI=1S/C13H18N2O4/c1-18-12-5-3-4-9(14-12)7-15-8-10(16)6-11(15)13(17)19-2/h3-5,10-11,16H,6-8H2,1-2H3 |
| InChIKey | AJHCTLPGGNBSDA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |