C12H15ClINO — CID 112633652
3-(2-chloro-4-iodoanilino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 112633652) has the molecular formula C12H15ClINO and a molecular weight of 351.62 g/mol. Its IUPAC name is 3-(2-chloro-4-iodoanilino)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(2-chloro-4-iodoanilino)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112633652 |
| Molecular Formula | C12H15ClINO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 3-(2-chloro-4-iodoanilino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H15ClINO/c1-12(2)10(6-11(12)16)15-9-4-3-7(14)5-8(9)13/h3-5,10-11,15-16H,6H2,1-2H3 |
| InChIKey | LNLISEYLIAGAFL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|