C8H14N2S2 — CID 112640847
3-(1,3-thiazol-5-ylmethylsulfanyl)butan-1-amine (PubChem CID 112640847) has the molecular formula C8H14N2S2 and a molecular weight of 202.35 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-ylmethylsulfanyl)butan-1-amine.
| Compound Name | 3-(1,3-thiazol-5-ylmethylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 112640847 |
| Molecular Formula | C8H14N2S2 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-(1,3-thiazol-5-ylmethylsulfanyl)butan-1-amine |
| SMILES | CC(CCN)SCc1cncs1 |
| InChI | InChI=1S/C8H14N2S2/c1-7(2-3-9)11-5-8-4-10-6-12-8/h4,6-7H,2-3,5,9H2,1H3 |
| InChIKey | YJWGZIKGOFBHSU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |