6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid

C10H8N2O3S — CID 112641073

IUPAC6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(=O)n(Cc2cncs2)c1
InChIInChI=1S/C10H8N2O3S/c13-9-2-1-7(10(14)15)4-12(9)5-8-3-11-6-16-8/h1-4,6H,5H2,(H,14,15)
InChIKeyHRMRSUPYKQGJIU-UHFFFAOYSA-N
MW236.25 g/mol
LogP1.05
Rot. Bonds3

About 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid

6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid (PubChem CID 112641073) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid
PubChem CID112641073
Molecular FormulaC10H8N2O3S
Molecular Weight236.25 g/mol
Exact Mass236.03
IUPAC Name6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(=O)n(Cc2cncs2)c1
InChIInChI=1S/C10H8N2O3S/c13-9-2-1-7(10(14)15)4-12(9)5-8-3-11-6-16-8/h1-4,6H,5H2,(H,14,15)
InChIKeyHRMRSUPYKQGJIU-UHFFFAOYSA-N
XLogP1.05
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.25
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid?
The IUPAC name of 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid (CID 112641073) is 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid is O=C(O)c1ccc(=O)n(Cc2cncs2)c1.
What is the InChIKey of 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid?
The InChIKey is HRMRSUPYKQGJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c13-9-2-1-7(10(14)15)4-12(9)5-8-3-11-6-16-8/h1-4,6H,5H2,(H,14,15).
What are the key properties of 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid?
6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid has a molecular weight of 236.25 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 112641073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).