C10H8N2O3S — CID 112641073
6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid (PubChem CID 112641073) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid.
| Compound Name | 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 112641073 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 6-oxo-1-(1,3-thiazol-5-ylmethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)n(Cc2cncs2)c1 |
| InChI | InChI=1S/C10H8N2O3S/c13-9-2-1-7(10(14)15)4-12(9)5-8-3-11-6-16-8/h1-4,6H,5H2,(H,14,15) |
| InChIKey | HRMRSUPYKQGJIU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |