C13H11N3O2S — CID 141395976
methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate (PubChem CID 141395976) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 141395976 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)ncn2Cc1cncs1 |
| InChI | InChI=1S/C13H11N3O2S/c1-18-13(17)9-2-3-12-11(4-9)15-7-16(12)6-10-5-14-8-19-10/h2-5,7-8H,6H2,1H3 |
| InChIKey | YJDFRMNJXLZMJP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |