methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate

C13H11N3O2S — CID 141395976

IUPACmethyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)ncn2Cc1cncs1
InChIInChI=1S/C13H11N3O2S/c1-18-13(17)9-2-3-12-11(4-9)15-7-16(12)6-10-5-14-8-19-10/h2-5,7-8H,6H2,1H3
InChIKeyYJDFRMNJXLZMJP-UHFFFAOYSA-N
MW273.32 g/mol
LogP2.33
Rot. Bonds3

About methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate

methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate (PubChem CID 141395976) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate
PubChem CID141395976
Molecular FormulaC13H11N3O2S
Molecular Weight273.32 g/mol
Exact Mass273.06
IUPAC Namemethyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)ncn2Cc1cncs1
InChIInChI=1S/C13H11N3O2S/c1-18-13(17)9-2-3-12-11(4-9)15-7-16(12)6-10-5-14-8-19-10/h2-5,7-8H,6H2,1H3
InChIKeyYJDFRMNJXLZMJP-UHFFFAOYSA-N
XLogP2.33
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.32
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate?
The IUPAC name of methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate (CID 141395976) is methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate.
What is the SMILES notation for methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate?
The canonical SMILES for methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate is COC(=O)c1ccc2c(c1)ncn2Cc1cncs1.
What is the InChIKey of methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate?
The InChIKey is YJDFRMNJXLZMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c1-18-13(17)9-2-3-12-11(4-9)15-7-16(12)6-10-5-14-8-19-10/h2-5,7-8H,6H2,1H3.
What are the key properties of methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate?
methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate has a molecular weight of 273.32 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(1,3-thiazol-5-ylmethyl)benzimidazole-5-carboxylate is sourced from PubChem (CID 141395976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).