C9H16N4O2 — CID 11264312
4-amino-5-ethyl-1-(2-methoxyethyl)pyrazole-3-carboxamide (PubChem CID 11264312) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-amino-5-ethyl-1-(2-methoxyethyl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-1-(2-methoxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 11264312 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-amino-5-ethyl-1-(2-methoxyethyl)pyrazole-3-carboxamide |
| SMILES | CCc1c(N)c(C(N)=O)nn1CCOC |
| InChI | InChI=1S/C9H16N4O2/c1-3-6-7(10)8(9(11)14)12-13(6)4-5-15-2/h3-5,10H2,1-2H3,(H2,11,14) |
| InChIKey | GHKYDKKHTDOYEI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |