C9H13F3N4O2 — CID 69368658
4-amino-1-(2-ethoxyethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 69368658) has the molecular formula C9H13F3N4O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 4-amino-1-(2-ethoxyethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-(2-ethoxyethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69368658 |
| Molecular Formula | C9H13F3N4O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-amino-1-(2-ethoxyethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCOCCn1nc(C(F)(F)F)c(N)c1C(N)=O |
| InChI | InChI=1S/C9H13F3N4O2/c1-2-18-4-3-16-6(8(14)17)5(13)7(15-16)9(10,11)12/h2-4,13H2,1H3,(H2,14,17) |
| InChIKey | YCFMAXYHXWUZNJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|