C12H12N4S — CID 112644531
[1-(1,3-thiazol-5-ylmethyl)indazol-3-yl]methanamine (PubChem CID 112644531) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-ylmethyl)indazol-3-yl]methanamine.
| Compound Name | [1-(1,3-thiazol-5-ylmethyl)indazol-3-yl]methanamine |
|---|---|
| PubChem CID | 112644531 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [1-(1,3-thiazol-5-ylmethyl)indazol-3-yl]methanamine |
| SMILES | NCc1nn(Cc2cncs2)c2ccccc12 |
| InChI | InChI=1S/C12H12N4S/c13-5-11-10-3-1-2-4-12(10)16(15-11)7-9-6-14-8-17-9/h1-4,6,8H,5,7,13H2 |
| InChIKey | OMPQZICGEOQUQW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |