C14H15N3S — CID 112644320
2-[1-(1,3-thiazol-5-ylmethyl)indol-3-yl]ethanamine (PubChem CID 112644320) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-[1-(1,3-thiazol-5-ylmethyl)indol-3-yl]ethanamine.
| Compound Name | 2-[1-(1,3-thiazol-5-ylmethyl)indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 112644320 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[1-(1,3-thiazol-5-ylmethyl)indol-3-yl]ethanamine |
| SMILES | NCCc1cn(Cc2cncs2)c2ccccc12 |
| InChI | InChI=1S/C14H15N3S/c15-6-5-11-8-17(9-12-7-16-10-18-12)14-4-2-1-3-13(11)14/h1-4,7-8,10H,5-6,9,15H2 |
| InChIKey | VSFZEOWOMIWFOP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |