C14H14ClN3S — CID 170887891
2-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]ethanamine (PubChem CID 170887891) has the molecular formula C14H14ClN3S and a molecular weight of 291.81 g/mol. Its IUPAC name is 2-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]ethanamine.
| Compound Name | 2-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 170887891 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]ethanamine |
| SMILES | NCCc1cn(Cc2cnc(Cl)s2)c2ccccc12 |
| InChI | InChI=1S/C14H14ClN3S/c15-14-17-7-11(19-14)9-18-8-10(5-6-16)12-3-1-2-4-13(12)18/h1-4,7-8H,5-6,9,16H2 |
| InChIKey | ITUBBXXYWGBTFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |