C15H12ClN3OS — CID 170876902
(Z)-3-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 170876902) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is (Z)-3-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (Z)-3-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170876902 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (Z)-3-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C\c1cn(Cc2cnc(Cl)s2)c2ccccc12 |
| InChI | InChI=1S/C15H12ClN3OS/c16-15-18-7-11(21-15)9-19-8-10(5-6-14(17)20)12-3-1-2-4-13(12)19/h1-8H,9H2,(H2,17,20)/b6-5- |
| InChIKey | FJMPBZIJSVGGJU-WAYWQWQTSA-N |
| XLogP | 3.30 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|