C6H5ClN2OS — CID 55267141
(E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 55267141) has the molecular formula C6H5ClN2OS and a molecular weight of 188.64 g/mol. Its IUPAC name is (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55267141 |
| Molecular Formula | C6H5ClN2OS |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H5ClN2OS/c7-6-9-3-4(11-6)1-2-5(8)10/h1-3H,(H2,8,10)/b2-1+ |
| InChIKey | WDYAAAPLPLKIOQ-OWOJBTEDSA-N |
| XLogP | 1.29 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|