C6H4ClNO2S — CID 68877521
(E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enoic acid (PubChem CID 68877521) has the molecular formula C6H4ClNO2S and a molecular weight of 189.62 g/mol. Its IUPAC name is (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 68877521 |
| Molecular Formula | C6H4ClNO2S |
| Molecular Weight | 189.62 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | (E)-3-(2-chloro-1,3-thiazol-5-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H4ClNO2S/c7-6-8-3-4(11-6)1-2-5(9)10/h1-3H,(H,9,10)/b2-1+ |
| InChIKey | KTWJSXZDKFIPAF-OWOJBTEDSA-N |
| XLogP | 1.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|