C12H8BrNO2S — CID 82308815
(E)-3-[2-(2-bromophenyl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82308815) has the molecular formula C12H8BrNO2S and a molecular weight of 310.17 g/mol. Its IUPAC name is (E)-3-[2-(2-bromophenyl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2-bromophenyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82308815 |
| Molecular Formula | C12H8BrNO2S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | (E)-3-[2-(2-bromophenyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(-c2ccccc2Br)s1 |
| InChI | InChI=1S/C12H8BrNO2S/c13-10-4-2-1-3-9(10)12-14-7-8(17-12)5-6-11(15)16/h1-7H,(H,15,16)/b6-5+ |
| InChIKey | MIPWSUBGJUAEOL-AATRIKPKSA-N |
| XLogP | 3.67 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|