C10H8N2O5S — CID 54971633
3-[2-(3,5-dioxomorpholin-4-yl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 54971633) has the molecular formula C10H8N2O5S and a molecular weight of 268.25 g/mol. Its IUPAC name is 3-[2-(3,5-dioxomorpholin-4-yl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(3,5-dioxomorpholin-4-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54971633 |
| Molecular Formula | C10H8N2O5S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 3-[2-(3,5-dioxomorpholin-4-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc(N2C(=O)COCC2=O)s1 |
| InChI | InChI=1S/C10H8N2O5S/c13-7-4-17-5-8(14)12(7)10-11-3-6(18-10)1-2-9(15)16/h1-3H,4-5H2,(H,15,16) |
| InChIKey | RJZWNDPMHPXGHK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|