C9H10ClNS — CID 112644759
5-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole (PubChem CID 112644759) has the molecular formula C9H10ClNS and a molecular weight of 199.71 g/mol. Its IUPAC name is 5-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112644759 |
| Molecular Formula | C9H10ClNS |
| Molecular Weight | 199.71 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5-[(3-chlorocyclopenten-1-yl)methyl]-1,3-thiazole |
| SMILES | ClC1C=C(Cc2cncs2)CC1 |
| InChI | InChI=1S/C9H10ClNS/c10-8-2-1-7(3-8)4-9-5-11-6-12-9/h3,5-6,8H,1-2,4H2 |
| InChIKey | SQEPKOPQDSDHJH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|