C11H14O5 — CID 11264617
[(1S,5R)-5-(hydroxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate (PubChem CID 11264617) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is [(1S,5R)-5-(hydroxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate.
| Compound Name | [(1S,5R)-5-(hydroxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11264617 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(1S,5R)-5-(hydroxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C=C[C@@](CO)(CC(=O)C1)O2 |
| InChI | InChI=1S/C11H14O5/c1-8(13)15-7-11-3-2-10(6-12,16-11)4-9(14)5-11/h2-3,12H,4-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | QOMGZLFRQMUMEH-WDEREUQCSA-N |
| XLogP | -0.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|