C13H16O6 — CID 101140421
[(1R,5S)-5-(acetyloxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate (PubChem CID 101140421) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is [(1R,5S)-5-(acetyloxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate.
| Compound Name | [(1R,5S)-5-(acetyloxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 101140421 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [(1R,5S)-5-(acetyloxymethyl)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C=C[C@@](COC(C)=O)(CC(=O)C1)O2 |
| InChI | InChI=1S/C13H16O6/c1-9(14)17-7-12-3-4-13(19-12,6-11(16)5-12)8-18-10(2)15/h3-4H,5-8H2,1-2H3/t12-,13+ |
| InChIKey | GNYUXGZGGUOZDB-BETUJISGSA-N |
| XLogP | 0.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|