C15H22O5 — CID 134963902
tert-butyl (1R,5R)-7-ethoxy-5-methyl-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate (PubChem CID 134963902) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl (1R,5R)-7-ethoxy-5-methyl-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate.
| Compound Name | tert-butyl (1R,5R)-7-ethoxy-5-methyl-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
|---|---|
| PubChem CID | 134963902 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | tert-butyl (1R,5R)-7-ethoxy-5-methyl-2-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
| SMILES | CCOC1=C[C@@]2(C)CCC(=O)[C@]1(C(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C15H22O5/c1-6-18-11-9-14(5)8-7-10(16)15(11,20-14)12(17)19-13(2,3)4/h9H,6-8H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | XXUHIADIAPACAG-CABCVRRESA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|