C19H24O8 — CID 122378795
1-O-ethyl 6-O,7-O-dimethyl (1R,5S)-2-oxo-5-[(E)-pent-1-enyl]-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate (PubChem CID 122378795) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is 1-O-ethyl 6-O,7-O-dimethyl (1R,5S)-2-oxo-5-[(E)-pent-1-enyl]-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate.
| Compound Name | 1-O-ethyl 6-O,7-O-dimethyl (1R,5S)-2-oxo-5-[(E)-pent-1-enyl]-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate |
|---|---|
| PubChem CID | 122378795 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-O-ethyl 6-O,7-O-dimethyl (1R,5S)-2-oxo-5-[(E)-pent-1-enyl]-8-oxabicyclo[3.2.1]oct-6-ene-1,6,7-tricarboxylate |
| SMILES | CCC/C=C/[C@]12CCC(=O)[C@](C(=O)OCC)(O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C19H24O8/c1-5-7-8-10-18-11-9-12(20)19(27-18,17(23)26-6-2)14(16(22)25-4)13(18)15(21)24-3/h8,10H,5-7,9,11H2,1-4H3/b10-8+/t18-,19+/m1/s1 |
| InChIKey | ABCAGTWRFPNYKF-MWGMDKCCSA-N |
| XLogP | 1.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|