C19H24O6 — CID 46900160
8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,8R)-1,5-dimethyl-7-oxo-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate (PubChem CID 46900160) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,8R)-1,5-dimethyl-7-oxo-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate.
| Compound Name | 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,8R)-1,5-dimethyl-7-oxo-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 46900160 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,8R)-1,5-dimethyl-7-oxo-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C[C@@]2(C(=O)OCC)O[C@]1(C)[C@@H]1CC[C@@H](C)[C@H]1C2=O |
| InChI | InChI=1S/C19H24O6/c1-5-9-24-16(21)13-10-19(17(22)23-6-2)15(20)14-11(3)7-8-12(14)18(13,4)25-19/h5,10-12,14H,1,6-9H2,2-4H3/t11-,12-,14-,18-,19-/m1/s1 |
| InChIKey | ZCHPIUQGQVXULR-WNUXUTQBSA-N |
| XLogP | 1.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|