C25H40O6Si — CID 46900161
8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate (PubChem CID 46900161) has the molecular formula C25H40O6Si and a molecular weight of 464.68 g/mol. Its IUPAC name is 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate.
| Compound Name | 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 46900161 |
| Molecular Formula | C25H40O6Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 8-O-ethyl 10-O-prop-2-enyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8,10-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C[C@@]2(C(=O)OCC)O[C@]1(C)[C@@H]1CC[C@@H](C)[C@H]1[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H40O6Si/c1-8-15-29-22(26)19-16-25(23(27)28-9-2)21(30-32(10-3,11-4)12-5)20-17(6)13-14-18(20)24(19,7)31-25/h8,16-18,20-21H,1,9-15H2,2-7H3/t17-,18-,20-,21-,24-,25-/m1/s1 |
| InChIKey | VXVLBOFQTVEKKE-UDLQGNBSSA-N |
| XLogP | 4.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|