C22H35N3O5Si — CID 46900162
ethyl (1R,2R,5R,6R,7R,8R)-10-carbonazidoyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8-carboxylate (PubChem CID 46900162) has the molecular formula C22H35N3O5Si and a molecular weight of 449.62 g/mol. Its IUPAC name is ethyl (1R,2R,5R,6R,7R,8R)-10-carbonazidoyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8-carboxylate.
| Compound Name | ethyl (1R,2R,5R,6R,7R,8R)-10-carbonazidoyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8-carboxylate |
|---|---|
| PubChem CID | 46900162 |
| Molecular Formula | C22H35N3O5Si |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | ethyl (1R,2R,5R,6R,7R,8R)-10-carbonazidoyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-8-carboxylate |
| SMILES | CCOC(=O)[C@]12C=C(C(=O)N=[N+]=[N-])[C@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H35N3O5Si/c1-7-28-20(27)22-13-16(19(26)24-25-23)21(6,30-22)15-12-11-14(5)17(15)18(22)29-31(8-2,9-3)10-4/h13-15,17-18H,7-12H2,1-6H3/t14-,15-,17-,18-,21-,22-/m1/s1 |
| InChIKey | WSIXXUXMWBLCNZ-HLEMCZNHSA-N |
| XLogP | 4.91 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|