C37H57NO8 — CID 118585637
[(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] propanoate (PubChem CID 118585637) has the molecular formula C37H57NO8 and a molecular weight of 643.86 g/mol. Its IUPAC name is [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] propanoate.
| Compound Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] propanoate |
|---|---|
| PubChem CID | 118585637 |
| Molecular Formula | C37H57NO8 |
| Molecular Weight | 643.86 g/mol |
| Exact Mass | 643.41 |
| IUPAC Name | [(Z)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] propanoate |
| SMILES | CCC(=O)O/N=C(/C[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C37H57NO8/c1-8-32(39)42-38-28(33-23(5)27-12-10-21(3)25-14-16-35(7)19-31(41-33)37(25,27)46-44-35)17-29-22(4)26-11-9-20(2)24-13-15-34(6)18-30(40-29)36(24,26)45-43-34/h20-27,29-31,33H,8-19H2,1-7H3/b38-28-/t20-,21-,22-,23-,24+,25+,26+,27+,29-,30-,31-,33+,34+,35+,36-,37-/m1/s1 |
| InChIKey | BXJHSQUGHYOMLN-FUOZTBKYSA-N |
| XLogP | 7.10 |
| TPSA | 94.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.86 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|