C35H55NO6 — CID 118585609
N-methyl-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine (PubChem CID 118585609) has the molecular formula C35H55NO6 and a molecular weight of 585.83 g/mol. Its IUPAC name is N-methyl-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine.
| Compound Name | N-methyl-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
|---|---|
| PubChem CID | 118585609 |
| Molecular Formula | C35H55NO6 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | N-methyl-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
| SMILES | C/N=C(/C[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C35H55NO6/c1-19-8-10-25-21(3)28(37-29-17-32(5)14-12-23(19)34(25,29)41-39-32)16-27(36-7)31-22(4)26-11-9-20(2)24-13-15-33(6)18-30(38-31)35(24,26)42-40-33/h19-26,28-31H,8-18H2,1-7H3/b36-27-/t19-,20-,21-,22-,23+,24+,25+,26+,28-,29-,30-,31+,32+,33+,34-,35-/m1/s1 |
| InChIKey | HSELRXKLWMSNBK-BKEYHVRSSA-N |
| XLogP | 6.87 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|