C41H57NO9 — CID 123854375
[1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] phenyl carbonate (PubChem CID 123854375) has the molecular formula C41H57NO9 and a molecular weight of 707.91 g/mol. Its IUPAC name is [1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] phenyl carbonate.
| Compound Name | [1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] phenyl carbonate |
|---|---|
| PubChem CID | 123854375 |
| Molecular Formula | C41H57NO9 |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.40 |
| IUPAC Name | [1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethylideneamino] phenyl carbonate |
| SMILES | C[C@H]1[C@@H](C(C[C@H]2O[C@@H]3C[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)=NOC(=O)Oc2ccccc2)O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C41H57NO9/c1-23-12-14-30-25(3)33(45-34-21-38(5)18-16-28(23)40(30,34)50-48-38)20-32(42-47-37(43)44-27-10-8-7-9-11-27)36-26(4)31-15-13-24(2)29-17-19-39(6)22-35(46-36)41(29,31)51-49-39/h7-11,23-26,28-31,33-36H,12-22H2,1-6H3/t23-,24-,25-,26-,28+,29+,30+,31+,33-,34-,35-,36+,38+,39+,40-,41-/m1/s1 |
| InChIKey | NXXKTLCJADPYBT-QEQVOHLQSA-N |
| XLogP | 8.37 |
| TPSA | 103.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|