C40H58N2O6 — CID 123140343
1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl-phenyldiazene (PubChem CID 123140343) has the molecular formula C40H58N2O6 and a molecular weight of 662.91 g/mol. Its IUPAC name is 1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl-phenyldiazene.
| Compound Name | 1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl-phenyldiazene |
|---|---|
| PubChem CID | 123140343 |
| Molecular Formula | C40H58N2O6 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | 1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl-phenyldiazene |
| SMILES | C[C@H]1[C@@H](C(C[C@H]2O[C@@H]3C[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)/N=N/c2ccccc2)O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C40H58N2O6/c1-23-12-14-30-25(3)33(43-34-21-37(5)18-16-28(23)39(30,34)47-45-37)20-32(42-41-27-10-8-7-9-11-27)36-26(4)31-15-13-24(2)29-17-19-38(6)22-35(44-36)40(29,31)48-46-38/h7-11,23-26,28-36H,12-22H2,1-6H3/b42-41+/t23-,24-,25-,26-,28+,29+,30+,31+,32?,33-,34-,35-,36+,37+,38+,39-,40-/m1/s1 |
| InChIKey | OFHPOVRXQPUYBQ-BXGRZLFCSA-N |
| XLogP | 8.95 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|