C37H55NO7 — CID 123219326
N-prop-2-ynoxy-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine (PubChem CID 123219326) has the molecular formula C37H55NO7 and a molecular weight of 625.85 g/mol. Its IUPAC name is N-prop-2-ynoxy-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine.
| Compound Name | N-prop-2-ynoxy-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
|---|---|
| PubChem CID | 123219326 |
| Molecular Formula | C37H55NO7 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | N-prop-2-ynoxy-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethanimine |
| SMILES | C#CCON=C(C[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)[C@H]1O[C@@H]2C[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C37H55NO7/c1-8-17-39-38-29(33-24(5)28-12-10-22(3)26-14-16-35(7)20-32(41-33)37(26,28)45-43-35)18-30-23(4)27-11-9-21(2)25-13-15-34(6)19-31(40-30)36(25,27)44-42-34/h1,21-28,30-33H,9-20H2,2-7H3/t21-,22-,23-,24-,25+,26+,27+,28+,30-,31-,32-,33+,34+,35+,36-,37-/m1/s1 |
| InChIKey | ZJAZVRFLDGJQLR-TYJKXWACSA-N |
| XLogP | 6.80 |
| TPSA | 76.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|