C12H12N4O3 — CID 23157148
ethyl 7-azido-8-oxo-5,6-dihydroquinoline-7-carboxylate (PubChem CID 23157148) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is ethyl 7-azido-8-oxo-5,6-dihydroquinoline-7-carboxylate.
| Compound Name | ethyl 7-azido-8-oxo-5,6-dihydroquinoline-7-carboxylate |
|---|---|
| PubChem CID | 23157148 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | ethyl 7-azido-8-oxo-5,6-dihydroquinoline-7-carboxylate |
| SMILES | CCOC(=O)C1(N=[N+]=[N-])CCc2cccnc2C1=O |
| InChI | InChI=1S/C12H12N4O3/c1-2-19-11(18)12(15-16-13)6-5-8-4-3-7-14-9(8)10(12)17/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | XXYXIRPRRFJMQO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|