C13H22O2S — CID 10800231
ethyl (1R,5S)-1,2,2,4-tetramethyl-5-methylsulfanylcyclopent-3-ene-1-carboxylate (PubChem CID 10800231) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is ethyl (1R,5S)-1,2,2,4-tetramethyl-5-methylsulfanylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5S)-1,2,2,4-tetramethyl-5-methylsulfanylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10800231 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl (1R,5S)-1,2,2,4-tetramethyl-5-methylsulfanylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@@H](SC)C(C)=CC1(C)C |
| InChI | InChI=1S/C13H22O2S/c1-7-15-11(14)13(5)10(16-6)9(2)8-12(13,3)4/h8,10H,7H2,1-6H3/t10-,13-/m0/s1 |
| InChIKey | LUBXYMGYONVJQK-GWCFXTLKSA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|